C17H18BrNO — CID 114315688
N-(2-bromo-2-cyclopropylethyl)-2-naphthalen-2-ylacetamide (PubChem CID 114315688) has the molecular formula C17H18BrNO and a molecular weight of 332.24 g/mol. Its IUPAC name is N-(2-bromo-2-cyclopropylethyl)-2-naphthalen-2-ylacetamide.
| Compound Name | N-(2-bromo-2-cyclopropylethyl)-2-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 114315688 |
| Molecular Formula | C17H18BrNO |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N-(2-bromo-2-cyclopropylethyl)-2-naphthalen-2-ylacetamide |
| SMILES | O=C(Cc1ccc2ccccc2c1)NCC(Br)C1CC1 |
| InChI | InChI=1S/C17H18BrNO/c18-16(14-7-8-14)11-19-17(20)10-12-5-6-13-3-1-2-4-15(13)9-12/h1-6,9,14,16H,7-8,10-11H2,(H,19,20) |
| InChIKey | YTCVPDATOJIFPB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|