C19H23NO2 — CID 111460495
N-[(3-hydroxycyclohexyl)methyl]-2-naphthalen-2-ylacetamide (PubChem CID 111460495) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is N-[(3-hydroxycyclohexyl)methyl]-2-naphthalen-2-ylacetamide.
| Compound Name | N-[(3-hydroxycyclohexyl)methyl]-2-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 111460495 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N-[(3-hydroxycyclohexyl)methyl]-2-naphthalen-2-ylacetamide |
| SMILES | O=C(Cc1ccc2ccccc2c1)NCC1CCCC(O)C1 |
| InChI | InChI=1S/C19H23NO2/c21-18-7-3-4-15(11-18)13-20-19(22)12-14-8-9-16-5-1-2-6-17(16)10-14/h1-2,5-6,8-10,15,18,21H,3-4,7,11-13H2,(H,20,22) |
| InChIKey | PPJZLGXJKKJFDC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |