C18H21NO2 — CID 104927093
N-[(1R,2R)-2-hydroxycyclohexyl]-2-naphthalen-2-ylacetamide (PubChem CID 104927093) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is N-[(1R,2R)-2-hydroxycyclohexyl]-2-naphthalen-2-ylacetamide.
| Compound Name | N-[(1R,2R)-2-hydroxycyclohexyl]-2-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 104927093 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | N-[(1R,2R)-2-hydroxycyclohexyl]-2-naphthalen-2-ylacetamide |
| SMILES | O=C(Cc1ccc2ccccc2c1)N[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C18H21NO2/c20-17-8-4-3-7-16(17)19-18(21)12-13-9-10-14-5-1-2-6-15(14)11-13/h1-2,5-6,9-11,16-17,20H,3-4,7-8,12H2,(H,19,21)/t16-,17-/m1/s1 |
| InChIKey | QXVWGIROXOAPSV-IAGOWNOFSA-N |
| XLogP | 2.80 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |