C18H19NO2 — CID 133268711
2-naphthalen-2-yl-N-[(1R,5S,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]acetamide (PubChem CID 133268711) has the molecular formula C18H19NO2 and a molecular weight of 281.35 g/mol. Its IUPAC name is 2-naphthalen-2-yl-N-[(1R,5S,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]acetamide.
| Compound Name | 2-naphthalen-2-yl-N-[(1R,5S,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]acetamide |
|---|---|
| PubChem CID | 133268711 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2-naphthalen-2-yl-N-[(1R,5S,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]acetamide |
| SMILES | O=C(Cc1ccc2ccccc2c1)N[C@@H]1C[C@H]2OCC[C@@H]12 |
| InChI | InChI=1S/C18H19NO2/c20-18(19-16-11-17-15(16)7-8-21-17)10-12-5-6-13-3-1-2-4-14(13)9-12/h1-6,9,15-17H,7-8,10-11H2,(H,19,20)/t15-,16+,17+/m0/s1 |
| InChIKey | SMRIFTQWZAKICY-GVDBMIGSSA-N |
| XLogP | 2.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |