C17H23NO2 — CID 133265817
N-[(1R,5S,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]-5-phenylpentanamide (PubChem CID 133265817) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is N-[(1R,5S,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]-5-phenylpentanamide.
| Compound Name | N-[(1R,5S,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]-5-phenylpentanamide |
|---|---|
| PubChem CID | 133265817 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | N-[(1R,5S,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]-5-phenylpentanamide |
| SMILES | O=C(CCCCc1ccccc1)N[C@@H]1C[C@H]2OCC[C@@H]12 |
| InChI | InChI=1S/C17H23NO2/c19-17(18-15-12-16-14(15)10-11-20-16)9-5-4-8-13-6-2-1-3-7-13/h1-3,6-7,14-16H,4-5,8-12H2,(H,18,19)/t14-,15+,16+/m0/s1 |
| InChIKey | BXWSVBSJTREFNG-ARFHVFGLSA-N |
| XLogP | 2.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|