C18H23ClN2O — CID 119600586
N-[2-(aminomethyl)cyclopentyl]-2-naphthalen-2-ylacetamide;hydrochloride (PubChem CID 119600586) has the molecular formula C18H23ClN2O and a molecular weight of 318.85 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-2-naphthalen-2-ylacetamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-2-naphthalen-2-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119600586 |
| Molecular Formula | C18H23ClN2O |
| Molecular Weight | 318.85 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-2-naphthalen-2-ylacetamide;hydrochloride |
| SMILES | Cl.NCC1CCCC1NC(=O)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H22N2O.ClH/c19-12-16-6-3-7-17(16)20-18(21)11-13-8-9-14-4-1-2-5-15(14)10-13;/h1-2,4-5,8-10,16-17H,3,6-7,11-12,19H2,(H,20,21);1H |
| InChIKey | BAKBCVIZNFZKGK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.85 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |