C28H30N2O8 — CID 145438409
4-methoxy-1-(naphthalen-2-ylmethyl)-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-3,6-bis(hydroxymethyl)oxan-3-yl]indole-3-carboxamide (PubChem CID 145438409) has the molecular formula C28H30N2O8 and a molecular weight of 522.55 g/mol. Its IUPAC name is 4-methoxy-1-(naphthalen-2-ylmethyl)-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-3,6-bis(hydroxymethyl)oxan-3-yl]indole-3-carboxamide.
| Compound Name | 4-methoxy-1-(naphthalen-2-ylmethyl)-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-3,6-bis(hydroxymethyl)oxan-3-yl]indole-3-carboxamide |
|---|---|
| PubChem CID | 145438409 |
| Molecular Formula | C28H30N2O8 |
| Molecular Weight | 522.55 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | 4-methoxy-1-(naphthalen-2-ylmethyl)-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-3,6-bis(hydroxymethyl)oxan-3-yl]indole-3-carboxamide |
| SMILES | COc1cccc2c1c(C(=O)N[C@@]1(CO)C(O)O[C@H](CO)[C@@H](O)[C@@H]1O)cn2Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H30N2O8/c1-37-21-8-4-7-20-23(21)19(13-30(20)12-16-9-10-17-5-2-3-6-18(17)11-16)26(35)29-28(15-32)25(34)24(33)22(14-31)38-27(28)36/h2-11,13,22,24-25,27,31-34,36H,12,14-15H2,1H3,(H,29,35)/t22-,24-,25+,27?,28-/m1/s1 |
| InChIKey | SAIMOLOZNBIGGA-NDJATNLGSA-N |
| XLogP | 0.74 |
| TPSA | 153.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.55 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |