C31H31N3O7 — CID 145201624
6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(naphthalen-2-ylmethyl)-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]indole-3-carboxamide (PubChem CID 145201624) has the molecular formula C31H31N3O7 and a molecular weight of 557.60 g/mol. Its IUPAC name is 6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(naphthalen-2-ylmethyl)-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]indole-3-carboxamide.
| Compound Name | 6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(naphthalen-2-ylmethyl)-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]indole-3-carboxamide |
|---|---|
| PubChem CID | 145201624 |
| Molecular Formula | C31H31N3O7 |
| Molecular Weight | 557.60 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | 6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(naphthalen-2-ylmethyl)-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]indole-3-carboxamide |
| SMILES | Cc1noc(C)c1-c1ccc2c(C(=O)N[C@H]3C(O)O[C@H](CO)[C@@H](O)[C@@H]3O)cn(Cc3ccc4ccccc4c3)c2c1 |
| InChI | InChI=1S/C31H31N3O7/c1-16-26(17(2)41-33-16)21-9-10-22-23(30(38)32-27-29(37)28(36)25(15-35)40-31(27)39)14-34(24(22)12-21)13-18-7-8-19-5-3-4-6-20(19)11-18/h3-12,14,25,27-29,31,35-37,39H,13,15H2,1-2H3,(H,32,38)/t25-,27-,28-,29-,31?/m1/s1 |
| InChIKey | HRXBNESWVYADTJ-RQJORNNASA-N |
| XLogP | 2.64 |
| TPSA | 150.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.60 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|