C23H24F2N2O2 — CID 144813115
N-cyclohexyl-4-fluoro-1-[(3-fluoro-4-methoxyphenyl)methyl]indole-3-carboxamide (PubChem CID 144813115) has the molecular formula C23H24F2N2O2 and a molecular weight of 398.45 g/mol. Its IUPAC name is N-cyclohexyl-4-fluoro-1-[(3-fluoro-4-methoxyphenyl)methyl]indole-3-carboxamide.
| Compound Name | N-cyclohexyl-4-fluoro-1-[(3-fluoro-4-methoxyphenyl)methyl]indole-3-carboxamide |
|---|---|
| PubChem CID | 144813115 |
| Molecular Formula | C23H24F2N2O2 |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | N-cyclohexyl-4-fluoro-1-[(3-fluoro-4-methoxyphenyl)methyl]indole-3-carboxamide |
| SMILES | COc1ccc(Cn2cc(C(=O)NC3CCCCC3)c3c(F)cccc32)cc1F |
| InChI | InChI=1S/C23H24F2N2O2/c1-29-21-11-10-15(12-19(21)25)13-27-14-17(22-18(24)8-5-9-20(22)27)23(28)26-16-6-3-2-4-7-16/h5,8-12,14,16H,2-4,6-7,13H2,1H3,(H,26,28) |
| InChIKey | ZNGSTHCFHNCQEI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |