C26H29FN2O2 — CID 159266559
N-cycloheptyl-4-fluoro-1-[(4-propanoylphenyl)methyl]indole-3-carboxamide (PubChem CID 159266559) has the molecular formula C26H29FN2O2 and a molecular weight of 420.53 g/mol. Its IUPAC name is N-cycloheptyl-4-fluoro-1-[(4-propanoylphenyl)methyl]indole-3-carboxamide.
| Compound Name | N-cycloheptyl-4-fluoro-1-[(4-propanoylphenyl)methyl]indole-3-carboxamide |
|---|---|
| PubChem CID | 159266559 |
| Molecular Formula | C26H29FN2O2 |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | N-cycloheptyl-4-fluoro-1-[(4-propanoylphenyl)methyl]indole-3-carboxamide |
| SMILES | CCC(=O)c1ccc(Cn2cc(C(=O)NC3CCCCCC3)c3c(F)cccc32)cc1 |
| InChI | InChI=1S/C26H29FN2O2/c1-2-24(30)19-14-12-18(13-15-19)16-29-17-21(25-22(27)10-7-11-23(25)29)26(31)28-20-8-5-3-4-6-9-20/h7,10-15,17,20H,2-6,8-9,16H2,1H3,(H,28,31) |
| InChIKey | KXEFOFAASXZQNJ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |