C26H27FN4O — CID 123838231
N-cyclohexyl-4-fluoro-1-[[4-(1-methylpyrazol-4-yl)phenyl]methyl]indole-3-carboxamide (PubChem CID 123838231) has the molecular formula C26H27FN4O and a molecular weight of 430.53 g/mol. Its IUPAC name is N-cyclohexyl-4-fluoro-1-[[4-(1-methylpyrazol-4-yl)phenyl]methyl]indole-3-carboxamide.
| Compound Name | N-cyclohexyl-4-fluoro-1-[[4-(1-methylpyrazol-4-yl)phenyl]methyl]indole-3-carboxamide |
|---|---|
| PubChem CID | 123838231 |
| Molecular Formula | C26H27FN4O |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | N-cyclohexyl-4-fluoro-1-[[4-(1-methylpyrazol-4-yl)phenyl]methyl]indole-3-carboxamide |
| SMILES | Cn1cc(-c2ccc(Cn3cc(C(=O)NC4CCCCC4)c4c(F)cccc43)cc2)cn1 |
| InChI | InChI=1S/C26H27FN4O/c1-30-16-20(14-28-30)19-12-10-18(11-13-19)15-31-17-22(25-23(27)8-5-9-24(25)31)26(32)29-21-6-3-2-4-7-21/h5,8-14,16-17,21H,2-4,6-7,15H2,1H3,(H,29,32) |
| InChIKey | ODYXCEBZXZQOKV-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |