C21H20F3N3O2 — CID 135312875
1-[(2,3-difluoro-4-pyridinyl)methyl]-4-fluoro-N-[(1S,2S)-2-hydroxycyclohexyl]indole-3-carboxamide (PubChem CID 135312875) has the molecular formula C21H20F3N3O2 and a molecular weight of 403.40 g/mol. Its IUPAC name is 1-[(2,3-difluoro-4-pyridinyl)methyl]-4-fluoro-N-[(1S,2S)-2-hydroxycyclohexyl]indole-3-carboxamide.
| Compound Name | 1-[(2,3-difluoro-4-pyridinyl)methyl]-4-fluoro-N-[(1S,2S)-2-hydroxycyclohexyl]indole-3-carboxamide |
|---|---|
| PubChem CID | 135312875 |
| Molecular Formula | C21H20F3N3O2 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 1-[(2,3-difluoro-4-pyridinyl)methyl]-4-fluoro-N-[(1S,2S)-2-hydroxycyclohexyl]indole-3-carboxamide |
| SMILES | O=C(N[C@H]1CCCC[C@@H]1O)c1cn(Cc2ccnc(F)c2F)c2cccc(F)c12 |
| InChI | InChI=1S/C21H20F3N3O2/c22-14-4-3-6-16-18(14)13(21(29)26-15-5-1-2-7-17(15)28)11-27(16)10-12-8-9-25-20(24)19(12)23/h3-4,6,8-9,11,15,17,28H,1-2,5,7,10H2,(H,26,29)/t15-,17-/m0/s1 |
| InChIKey | ZBTHEESTJGTHOH-RDJZCZTQSA-N |
| XLogP | 3.54 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|