C20H20ClF3N4O — CID 126674105
4-fluoro-N-[(3S,4R)-3-fluoropiperidin-4-yl]-1-[(2-fluoro-4-pyridinyl)methyl]indole-3-carboxamide;hydrochloride (PubChem CID 126674105) has the molecular formula C20H20ClF3N4O and a molecular weight of 424.85 g/mol. Its IUPAC name is 4-fluoro-N-[(3S,4R)-3-fluoropiperidin-4-yl]-1-[(2-fluoro-4-pyridinyl)methyl]indole-3-carboxamide;hydrochloride.
| Compound Name | 4-fluoro-N-[(3S,4R)-3-fluoropiperidin-4-yl]-1-[(2-fluoro-4-pyridinyl)methyl]indole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 126674105 |
| Molecular Formula | C20H20ClF3N4O |
| Molecular Weight | 424.85 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 4-fluoro-N-[(3S,4R)-3-fluoropiperidin-4-yl]-1-[(2-fluoro-4-pyridinyl)methyl]indole-3-carboxamide;hydrochloride |
| SMILES | Cl.O=C(N[C@@H]1CCNC[C@@H]1F)c1cn(Cc2ccnc(F)c2)c2cccc(F)c12 |
| InChI | InChI=1S/C20H19F3N4O.ClH/c21-14-2-1-3-17-19(14)13(20(28)26-16-5-6-24-9-15(16)22)11-27(17)10-12-4-7-25-18(23)8-12;/h1-4,7-8,11,15-16,24H,5-6,9-10H2,(H,26,28);1H/t15-,16+;/m0./s1 |
| InChIKey | ICCKGXKLYGTWGB-IDVLALEDSA-N |
| XLogP | 3.21 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.85 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|