C21H18F4N4O3 — CID 126674086
4-[[4,7-difluoro-1-[(2-fluoro-4-pyridinyl)methyl]indole-3-carbonyl]amino]-3-fluoropiperidine-1-carboxylic acid (PubChem CID 126674086) has the molecular formula C21H18F4N4O3 and a molecular weight of 450.39 g/mol. Its IUPAC name is 4-[[4,7-difluoro-1-[(2-fluoro-4-pyridinyl)methyl]indole-3-carbonyl]amino]-3-fluoropiperidine-1-carboxylic acid.
| Compound Name | 4-[[4,7-difluoro-1-[(2-fluoro-4-pyridinyl)methyl]indole-3-carbonyl]amino]-3-fluoropiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 126674086 |
| Molecular Formula | C21H18F4N4O3 |
| Molecular Weight | 450.39 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 4-[[4,7-difluoro-1-[(2-fluoro-4-pyridinyl)methyl]indole-3-carbonyl]amino]-3-fluoropiperidine-1-carboxylic acid |
| SMILES | O=C(NC1CCN(C(=O)O)CC1F)c1cn(Cc2ccnc(F)c2)c2c(F)ccc(F)c12 |
| InChI | InChI=1S/C21H18F4N4O3/c22-13-1-2-14(23)19-18(13)12(9-29(19)8-11-3-5-26-17(25)7-11)20(30)27-16-4-6-28(21(31)32)10-15(16)24/h1-3,5,7,9,15-16H,4,6,8,10H2,(H,27,30)(H,31,32) |
| InChIKey | NZEJJOPXJROYQT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|