C11H12FN3O3 — CID 122590844
3-[(2-fluoropyridine-4-carbonyl)amino]pyrrolidine-1-carboxylic acid (PubChem CID 122590844) has the molecular formula C11H12FN3O3 and a molecular weight of 253.23 g/mol. Its IUPAC name is 3-[(2-fluoropyridine-4-carbonyl)amino]pyrrolidine-1-carboxylic acid.
| Compound Name | 3-[(2-fluoropyridine-4-carbonyl)amino]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 122590844 |
| Molecular Formula | C11H12FN3O3 |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 3-[(2-fluoropyridine-4-carbonyl)amino]pyrrolidine-1-carboxylic acid |
| SMILES | O=C(NC1CCN(C(=O)O)C1)c1ccnc(F)c1 |
| InChI | InChI=1S/C11H12FN3O3/c12-9-5-7(1-3-13-9)10(16)14-8-2-4-15(6-8)11(17)18/h1,3,5,8H,2,4,6H2,(H,14,16)(H,17,18) |
| InChIKey | NXIVJCNIRIVQCO-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|