C14H19FI2N2O — CID 144683851
N-cyclohexyl-2-fluoropyridine-4-carboxamide;1,1-diiodoethane (PubChem CID 144683851) has the molecular formula C14H19FI2N2O and a molecular weight of 504.13 g/mol. Its IUPAC name is N-cyclohexyl-2-fluoropyridine-4-carboxamide;1,1-diiodoethane.
| Compound Name | N-cyclohexyl-2-fluoropyridine-4-carboxamide;1,1-diiodoethane |
|---|---|
| PubChem CID | 144683851 |
| Molecular Formula | C14H19FI2N2O |
| Molecular Weight | 504.13 g/mol |
| Exact Mass | 503.96 |
| IUPAC Name | N-cyclohexyl-2-fluoropyridine-4-carboxamide;1,1-diiodoethane |
| SMILES | CC(I)I.O=C(NC1CCCCC1)c1ccnc(F)c1 |
| InChI | InChI=1S/C12H15FN2O.C2H4I2/c13-11-8-9(6-7-14-11)12(16)15-10-4-2-1-3-5-10;1-2(3)4/h6-8,10H,1-5H2,(H,15,16);2H,1H3 |
| InChIKey | JYKYNZKJVLHUGP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.13 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|