C14H19FN2O — CID 90349705
N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-2-fluoropyridine-4-carboxamide (PubChem CID 90349705) has the molecular formula C14H19FN2O and a molecular weight of 250.32 g/mol. Its IUPAC name is N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-2-fluoropyridine-4-carboxamide.
| Compound Name | N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-2-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 90349705 |
| Molecular Formula | C14H19FN2O |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-2-fluoropyridine-4-carboxamide |
| SMILES | C[C@H]1[C@H](C)CCC[C@@H]1NC(=O)c1ccnc(F)c1 |
| InChI | InChI=1S/C14H19FN2O/c1-9-4-3-5-12(10(9)2)17-14(18)11-6-7-16-13(15)8-11/h6-10,12H,3-5H2,1-2H3,(H,17,18)/t9-,10+,12+/m1/s1 |
| InChIKey | RXTIBAJZELLNBT-SCVCMEIPSA-N |
| XLogP | 2.78 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|