C14H21FN4O — CID 105387958
N-(2,3-dimethylcyclohexyl)-3-fluoro-2-hydrazinylpyridine-4-carboxamide (PubChem CID 105387958) has the molecular formula C14H21FN4O and a molecular weight of 280.35 g/mol. Its IUPAC name is N-(2,3-dimethylcyclohexyl)-3-fluoro-2-hydrazinylpyridine-4-carboxamide.
| Compound Name | N-(2,3-dimethylcyclohexyl)-3-fluoro-2-hydrazinylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 105387958 |
| Molecular Formula | C14H21FN4O |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | N-(2,3-dimethylcyclohexyl)-3-fluoro-2-hydrazinylpyridine-4-carboxamide |
| SMILES | CC1CCCC(NC(=O)c2ccnc(NN)c2F)C1C |
| InChI | InChI=1S/C14H21FN4O/c1-8-4-3-5-11(9(8)2)18-14(20)10-6-7-17-13(19-16)12(10)15/h6-9,11H,3-5,16H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | BOMIQWKRKLFZRG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|