C15H20BrFN2O — CID 62814890
5-amino-2-bromo-N-(2,3-dimethylcyclohexyl)-4-fluorobenzamide (PubChem CID 62814890) has the molecular formula C15H20BrFN2O and a molecular weight of 343.24 g/mol. Its IUPAC name is 5-amino-2-bromo-N-(2,3-dimethylcyclohexyl)-4-fluorobenzamide.
| Compound Name | 5-amino-2-bromo-N-(2,3-dimethylcyclohexyl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 62814890 |
| Molecular Formula | C15H20BrFN2O |
| Molecular Weight | 343.24 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 5-amino-2-bromo-N-(2,3-dimethylcyclohexyl)-4-fluorobenzamide |
| SMILES | CC1CCCC(NC(=O)c2cc(N)c(F)cc2Br)C1C |
| InChI | InChI=1S/C15H20BrFN2O/c1-8-4-3-5-14(9(8)2)19-15(20)10-6-13(18)12(17)7-11(10)16/h6-9,14H,3-5,18H2,1-2H3,(H,19,20) |
| InChIKey | SEABINKMUDYBDT-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.24 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|