C14H20FN5O — CID 105388522
N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-3-fluoro-2-hydrazinylpyridine-4-carboxamide (PubChem CID 105388522) has the molecular formula C14H20FN5O and a molecular weight of 293.35 g/mol. Its IUPAC name is N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-3-fluoro-2-hydrazinylpyridine-4-carboxamide.
| Compound Name | N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-3-fluoro-2-hydrazinylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 105388522 |
| Molecular Formula | C14H20FN5O |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-3-fluoro-2-hydrazinylpyridine-4-carboxamide |
| SMILES | NNc1nccc(C(=O)NC2CCN3CCCC3C2)c1F |
| InChI | InChI=1S/C14H20FN5O/c15-12-11(3-5-17-13(12)19-16)14(21)18-9-4-7-20-6-1-2-10(20)8-9/h3,5,9-10H,1-2,4,6-8,16H2,(H,17,19)(H,18,21) |
| InChIKey | DMQOTLMJPYHSTR-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|