C15H19F2N3O — CID 107121293
3-amino-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-2,5-difluorobenzamide (PubChem CID 107121293) has the molecular formula C15H19F2N3O and a molecular weight of 295.33 g/mol. Its IUPAC name is 3-amino-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-2,5-difluorobenzamide.
| Compound Name | 3-amino-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 107121293 |
| Molecular Formula | C15H19F2N3O |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 3-amino-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-2,5-difluorobenzamide |
| SMILES | Nc1cc(F)cc(C(=O)NC2CCN3CCCC3C2)c1F |
| InChI | InChI=1S/C15H19F2N3O/c16-9-6-12(14(17)13(18)7-9)15(21)19-10-3-5-20-4-1-2-11(20)8-10/h6-7,10-11H,1-5,8,18H2,(H,19,21) |
| InChIKey | UPDLRXHBVHSSIV-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|