C13H20FN5O — CID 105388549
N-(2,6-dimethylpiperidin-1-yl)-3-fluoro-2-hydrazinylpyridine-4-carboxamide (PubChem CID 105388549) has the molecular formula C13H20FN5O and a molecular weight of 281.33 g/mol. Its IUPAC name is N-(2,6-dimethylpiperidin-1-yl)-3-fluoro-2-hydrazinylpyridine-4-carboxamide.
| Compound Name | N-(2,6-dimethylpiperidin-1-yl)-3-fluoro-2-hydrazinylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 105388549 |
| Molecular Formula | C13H20FN5O |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | N-(2,6-dimethylpiperidin-1-yl)-3-fluoro-2-hydrazinylpyridine-4-carboxamide |
| SMILES | CC1CCCC(C)N1NC(=O)c1ccnc(NN)c1F |
| InChI | InChI=1S/C13H20FN5O/c1-8-4-3-5-9(2)19(8)18-13(20)10-6-7-16-12(17-15)11(10)14/h6-9H,3-5,15H2,1-2H3,(H,16,17)(H,18,20) |
| InChIKey | PFFXZEDUXVOPKJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|