C12H14FN3O2 — CID 97084906
N-[(1R,2R)-2-carbamoylcyclopentyl]-2-fluoropyridine-4-carboxamide (PubChem CID 97084906) has the molecular formula C12H14FN3O2 and a molecular weight of 251.26 g/mol. Its IUPAC name is N-[(1R,2R)-2-carbamoylcyclopentyl]-2-fluoropyridine-4-carboxamide.
| Compound Name | N-[(1R,2R)-2-carbamoylcyclopentyl]-2-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 97084906 |
| Molecular Formula | C12H14FN3O2 |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | N-[(1R,2R)-2-carbamoylcyclopentyl]-2-fluoropyridine-4-carboxamide |
| SMILES | NC(=O)[C@@H]1CCC[C@H]1NC(=O)c1ccnc(F)c1 |
| InChI | InChI=1S/C12H14FN3O2/c13-10-6-7(4-5-15-10)12(18)16-9-3-1-2-8(9)11(14)17/h4-6,8-9H,1-3H2,(H2,14,17)(H,16,18)/t8-,9-/m1/s1 |
| InChIKey | UCAMDDBQMFSMPO-RKDXNWHRSA-N |
| XLogP | 0.60 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|