C14H16ClFN2O2 — CID 124601145
N-[(1R,2R)-2-carbamoylcyclohexyl]-3-chloro-4-fluorobenzamide (PubChem CID 124601145) has the molecular formula C14H16ClFN2O2 and a molecular weight of 298.75 g/mol. Its IUPAC name is N-[(1R,2R)-2-carbamoylcyclohexyl]-3-chloro-4-fluorobenzamide.
| Compound Name | N-[(1R,2R)-2-carbamoylcyclohexyl]-3-chloro-4-fluorobenzamide |
|---|---|
| PubChem CID | 124601145 |
| Molecular Formula | C14H16ClFN2O2 |
| Molecular Weight | 298.75 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | N-[(1R,2R)-2-carbamoylcyclohexyl]-3-chloro-4-fluorobenzamide |
| SMILES | NC(=O)[C@@H]1CCCC[C@H]1NC(=O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H16ClFN2O2/c15-10-7-8(5-6-11(10)16)14(20)18-12-4-2-1-3-9(12)13(17)19/h5-7,9,12H,1-4H2,(H2,17,19)(H,18,20)/t9-,12-/m1/s1 |
| InChIKey | LXRUOIVLAMVIGG-BXKDBHETSA-N |
| XLogP | 2.25 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.75 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |