C13H16ClN3O2 — CID 96528381
N-[(1S,2S)-2-carbamoylcyclohexyl]-5-chloropyridine-2-carboxamide (PubChem CID 96528381) has the molecular formula C13H16ClN3O2 and a molecular weight of 281.74 g/mol. Its IUPAC name is N-[(1S,2S)-2-carbamoylcyclohexyl]-5-chloropyridine-2-carboxamide.
| Compound Name | N-[(1S,2S)-2-carbamoylcyclohexyl]-5-chloropyridine-2-carboxamide |
|---|---|
| PubChem CID | 96528381 |
| Molecular Formula | C13H16ClN3O2 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | N-[(1S,2S)-2-carbamoylcyclohexyl]-5-chloropyridine-2-carboxamide |
| SMILES | NC(=O)[C@H]1CCCC[C@@H]1NC(=O)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C13H16ClN3O2/c14-8-5-6-11(16-7-8)13(19)17-10-4-2-1-3-9(10)12(15)18/h5-7,9-10H,1-4H2,(H2,15,18)(H,17,19)/t9-,10-/m0/s1 |
| InChIKey | YIUHCSDOUTWXQU-UWVGGRQHSA-N |
| XLogP | 1.51 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |