C10H12ClN3O2 — CID 122559914
5-chloro-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]pyridine-2-carboxamide (PubChem CID 122559914) has the molecular formula C10H12ClN3O2 and a molecular weight of 241.68 g/mol. Its IUPAC name is 5-chloro-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]pyridine-2-carboxamide.
| Compound Name | 5-chloro-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 122559914 |
| Molecular Formula | C10H12ClN3O2 |
| Molecular Weight | 241.68 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 5-chloro-N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]pyridine-2-carboxamide |
| SMILES | O=C(N[C@@H]1CNC[C@H]1O)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C10H12ClN3O2/c11-6-1-2-7(13-3-6)10(16)14-8-4-12-5-9(8)15/h1-3,8-9,12,15H,4-5H2,(H,14,16)/t8-,9-/m1/s1 |
| InChIKey | QEKAVUUFLJMPRF-RKDXNWHRSA-N |
| XLogP | -0.20 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.68 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |