C16H13ClFN3O2 — CID 95323518
N-[(3R)-1-(2-chlorophenyl)-5-oxopyrrolidin-3-yl]-2-fluoropyridine-4-carboxamide (PubChem CID 95323518) has the molecular formula C16H13ClFN3O2 and a molecular weight of 333.75 g/mol. Its IUPAC name is N-[(3R)-1-(2-chlorophenyl)-5-oxopyrrolidin-3-yl]-2-fluoropyridine-4-carboxamide.
| Compound Name | N-[(3R)-1-(2-chlorophenyl)-5-oxopyrrolidin-3-yl]-2-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 95323518 |
| Molecular Formula | C16H13ClFN3O2 |
| Molecular Weight | 333.75 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | N-[(3R)-1-(2-chlorophenyl)-5-oxopyrrolidin-3-yl]-2-fluoropyridine-4-carboxamide |
| SMILES | O=C(N[C@@H]1CC(=O)N(c2ccccc2Cl)C1)c1ccnc(F)c1 |
| InChI | InChI=1S/C16H13ClFN3O2/c17-12-3-1-2-4-13(12)21-9-11(8-15(21)22)20-16(23)10-5-6-19-14(18)7-10/h1-7,11H,8-9H2,(H,20,23)/t11-/m1/s1 |
| InChIKey | SXMWQSWZFAEEEX-LLVKDONJSA-N |
| XLogP | 2.41 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.75 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|