C21H20F2N4O3 — CID 166214840
1,3-bis[1-(2-fluorophenyl)-5-oxopyrrolidin-3-yl]urea (PubChem CID 166214840) has the molecular formula C21H20F2N4O3 and a molecular weight of 414.41 g/mol. Its IUPAC name is 1,3-bis[1-(2-fluorophenyl)-5-oxopyrrolidin-3-yl]urea.
| Compound Name | 1,3-bis[1-(2-fluorophenyl)-5-oxopyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 166214840 |
| Molecular Formula | C21H20F2N4O3 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 1,3-bis[1-(2-fluorophenyl)-5-oxopyrrolidin-3-yl]urea |
| SMILES | O=C(NC1CC(=O)N(c2ccccc2F)C1)NC1CC(=O)N(c2ccccc2F)C1 |
| InChI | InChI=1S/C21H20F2N4O3/c22-15-5-1-3-7-17(15)26-11-13(9-19(26)28)24-21(30)25-14-10-20(29)27(12-14)18-8-4-2-6-16(18)23/h1-8,13-14H,9-12H2,(H2,24,25,30) |
| InChIKey | DYLSYBFHRDBHCN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |