C22H24FN3O2 — CID 55360345
N-(1-benzylpyrrolidin-3-yl)-1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 55360345) has the molecular formula C22H24FN3O2 and a molecular weight of 381.45 g/mol. Its IUPAC name is N-(1-benzylpyrrolidin-3-yl)-1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-(1-benzylpyrrolidin-3-yl)-1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55360345 |
| Molecular Formula | C22H24FN3O2 |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | N-(1-benzylpyrrolidin-3-yl)-1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccccc2)C1)C1CC(=O)N(c2ccccc2F)C1 |
| InChI | InChI=1S/C22H24FN3O2/c23-19-8-4-5-9-20(19)26-14-17(12-21(26)27)22(28)24-18-10-11-25(15-18)13-16-6-2-1-3-7-16/h1-9,17-18H,10-15H2,(H,24,28) |
| InChIKey | BBUNWZBXNZTKES-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |