C18H23FN2O2 — CID 39710585
(3R)-1-(2-fluorophenyl)-N-(4-methylcyclohexyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 39710585) has the molecular formula C18H23FN2O2 and a molecular weight of 318.39 g/mol. Its IUPAC name is (3R)-1-(2-fluorophenyl)-N-(4-methylcyclohexyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(2-fluorophenyl)-N-(4-methylcyclohexyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 39710585 |
| Molecular Formula | C18H23FN2O2 |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | (3R)-1-(2-fluorophenyl)-N-(4-methylcyclohexyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CC1CCC(NC(=O)[C@@H]2CC(=O)N(c3ccccc3F)C2)CC1 |
| InChI | InChI=1S/C18H23FN2O2/c1-12-6-8-14(9-7-12)20-18(23)13-10-17(22)21(11-13)16-5-3-2-4-15(16)19/h2-5,12-14H,6-11H2,1H3,(H,20,23)/t12?,13-,14?/m1/s1 |
| InChIKey | CMVDRYHMZOZFQE-ROKHWSDSSA-N |
| XLogP | 2.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |