C19H26N2O2 — CID 974507
(3R)-N-(4-methylcyclohexyl)-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 974507) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is (3R)-N-(4-methylcyclohexyl)-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-(4-methylcyclohexyl)-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 974507 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | (3R)-N-(4-methylcyclohexyl)-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(N2C[C@H](C(=O)NC3CCC(C)CC3)CC2=O)cc1 |
| InChI | InChI=1S/C19H26N2O2/c1-13-3-7-16(8-4-13)20-19(23)15-11-18(22)21(12-15)17-9-5-14(2)6-10-17/h5-6,9-10,13,15-16H,3-4,7-8,11-12H2,1-2H3,(H,20,23)/t13?,15-,16?/m1/s1 |
| InChIKey | HHWNXIVRKAXJTJ-OGVSOVDVSA-N |
| XLogP | 3.04 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |