C16H21N3O4S — CID 45491488
N-cyclopropyl-1-[4-(dimethylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 45491488) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is N-cyclopropyl-1-[4-(dimethylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-cyclopropyl-1-[4-(dimethylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 45491488 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N-cyclopropyl-1-[4-(dimethylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(N2CC(C(=O)NC3CC3)CC2=O)cc1 |
| InChI | InChI=1S/C16H21N3O4S/c1-18(2)24(22,23)14-7-5-13(6-8-14)19-10-11(9-15(19)20)16(21)17-12-3-4-12/h5-8,11-12H,3-4,9-10H2,1-2H3,(H,17,21) |
| InChIKey | OCMQLKHCSLPFEZ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |