C18H25N3O4S — CID 8623353
(3R)-N-cyclopropyl-1-[4-(diethylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 8623353) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is (3R)-N-cyclopropyl-1-[4-(diethylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-cyclopropyl-1-[4-(diethylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 8623353 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | (3R)-N-cyclopropyl-1-[4-(diethylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2C[C@H](C(=O)NC3CC3)CC2=O)cc1 |
| InChI | InChI=1S/C18H25N3O4S/c1-3-20(4-2)26(24,25)16-9-7-15(8-10-16)21-12-13(11-17(21)22)18(23)19-14-5-6-14/h7-10,13-14H,3-6,11-12H2,1-2H3,(H,19,23)/t13-/m1/s1 |
| InChIKey | XWUSOPFWOBUROA-CYBMUJFWSA-N |
| XLogP | 1.35 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |