C24H29N3O6S — CID 17321875
ethyl 4-[[1-[4-(diethylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carbonyl]amino]benzoate (PubChem CID 17321875) has the molecular formula C24H29N3O6S and a molecular weight of 487.58 g/mol. Its IUPAC name is ethyl 4-[[1-[4-(diethylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carbonyl]amino]benzoate.
| Compound Name | ethyl 4-[[1-[4-(diethylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 17321875 |
| Molecular Formula | C24H29N3O6S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | ethyl 4-[[1-[4-(diethylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C2CC(=O)N(c3ccc(S(=O)(=O)N(CC)CC)cc3)C2)cc1 |
| InChI | InChI=1S/C24H29N3O6S/c1-4-26(5-2)34(31,32)21-13-11-20(12-14-21)27-16-18(15-22(27)28)23(29)25-19-9-7-17(8-10-19)24(30)33-6-3/h7-14,18H,4-6,15-16H2,1-3H3,(H,25,29) |
| InChIKey | YERWWRGOMQCOAZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |