C25H28FN3O2 — CID 121482780
N-cycloheptyl-4-fluoro-1-[[4-(methylcarbamoyl)phenyl]methyl]indole-3-carboxamide (PubChem CID 121482780) has the molecular formula C25H28FN3O2 and a molecular weight of 421.52 g/mol. Its IUPAC name is N-cycloheptyl-4-fluoro-1-[[4-(methylcarbamoyl)phenyl]methyl]indole-3-carboxamide.
| Compound Name | N-cycloheptyl-4-fluoro-1-[[4-(methylcarbamoyl)phenyl]methyl]indole-3-carboxamide |
|---|---|
| PubChem CID | 121482780 |
| Molecular Formula | C25H28FN3O2 |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | N-cycloheptyl-4-fluoro-1-[[4-(methylcarbamoyl)phenyl]methyl]indole-3-carboxamide |
| SMILES | CNC(=O)c1ccc(Cn2cc(C(=O)NC3CCCCCC3)c3c(F)cccc32)cc1 |
| InChI | InChI=1S/C25H28FN3O2/c1-27-24(30)18-13-11-17(12-14-18)15-29-16-20(23-21(26)9-6-10-22(23)29)25(31)28-19-7-4-2-3-5-8-19/h6,9-14,16,19H,2-5,7-8,15H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | LIPNBNDPTOSLEH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |