C25H26FN3O3 — CID 144813109
4-fluoro-N-(oxan-4-yl)-1-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]indole-3-carboxamide (PubChem CID 144813109) has the molecular formula C25H26FN3O3 and a molecular weight of 435.50 g/mol. Its IUPAC name is 4-fluoro-N-(oxan-4-yl)-1-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]indole-3-carboxamide.
| Compound Name | 4-fluoro-N-(oxan-4-yl)-1-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]indole-3-carboxamide |
|---|---|
| PubChem CID | 144813109 |
| Molecular Formula | C25H26FN3O3 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 4-fluoro-N-(oxan-4-yl)-1-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]indole-3-carboxamide |
| SMILES | O=C(NC1CCOCC1)c1cn(Cc2ccc(N3CCCC3=O)cc2)c2cccc(F)c12 |
| InChI | InChI=1S/C25H26FN3O3/c26-21-3-1-4-22-24(21)20(25(31)27-18-10-13-32-14-11-18)16-28(22)15-17-6-8-19(9-7-17)29-12-2-5-23(29)30/h1,3-4,6-9,16,18H,2,5,10-15H2,(H,27,31) |
| InChIKey | MZGOLHXMNONHEF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |