C42H35NO9 — CID 156700342
2-oxo-7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-N-[4-(1,2,2-triphenylethenyl)phenyl]chromene-3-carboxamide (PubChem CID 156700342) has the molecular formula C42H35NO9 and a molecular weight of 697.74 g/mol. Its IUPAC name is 2-oxo-7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-N-[4-(1,2,2-triphenylethenyl)phenyl]chromene-3-carboxamide.
| Compound Name | 2-oxo-7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-N-[4-(1,2,2-triphenylethenyl)phenyl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 156700342 |
| Molecular Formula | C42H35NO9 |
| Molecular Weight | 697.74 g/mol |
| Exact Mass | 697.23 |
| IUPAC Name | 2-oxo-7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-N-[4-(1,2,2-triphenylethenyl)phenyl]chromene-3-carboxamide |
| SMILES | O=C(Nc1ccc(C(=C(c2ccccc2)c2ccccc2)c2ccccc2)cc1)c1cc2ccc(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)cc2oc1=O |
| InChI | InChI=1S/C42H35NO9/c44-24-34-37(45)38(46)39(47)42(52-34)50-31-21-18-29-22-32(41(49)51-33(29)23-31)40(48)43-30-19-16-28(17-20-30)36(27-14-8-3-9-15-27)35(25-10-4-1-5-11-25)26-12-6-2-7-13-26/h1-23,34,37-39,42,44-47H,24H2,(H,43,48)/t34-,37+,38+,39-,42-/m1/s1 |
| InChIKey | FTCDFXODJUXGFB-QNJBOAHXSA-N |
| XLogP | 5.23 |
| TPSA | 158.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.74 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|