C23H21NO10 — CID 88740330
4-[[2-oxo-7-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromene-3-carbonyl]amino]benzoic acid (PubChem CID 88740330) has the molecular formula C23H21NO10 and a molecular weight of 471.42 g/mol. Its IUPAC name is 4-[[2-oxo-7-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromene-3-carbonyl]amino]benzoic acid.
| Compound Name | 4-[[2-oxo-7-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromene-3-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 88740330 |
| Molecular Formula | C23H21NO10 |
| Molecular Weight | 471.42 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | 4-[[2-oxo-7-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromene-3-carbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)c2cc3ccc([C@@H]4O[C@H](CO)[C@H](O)[C@H](O)[C@H]4O)cc3oc2=O)cc1 |
| InChI | InChI=1S/C23H21NO10/c25-9-16-17(26)18(27)19(28)20(33-16)12-2-1-11-7-14(23(32)34-15(11)8-12)21(29)24-13-5-3-10(4-6-13)22(30)31/h1-8,16-20,25-28H,9H2,(H,24,29)(H,30,31)/t16-,17+,18+,19-,20+/m1/s1 |
| InChIKey | OQFIYINOWCNMGW-CXQPBAHBSA-N |
| XLogP | 0.26 |
| TPSA | 186.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.42 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|