About N-naphthalen-2-yl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzamide
N-naphthalen-2-yl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzamide (PubChem CID 78162415) has the molecular formula C23H23NO6
and a molecular weight of 409.44 g/mol. Its IUPAC name is N-naphthalen-2-yl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzamide.
Molecular Properties
| Compound Name | N-naphthalen-2-yl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzamide |
| PubChem CID | 78162415 |
| Molecular Formula | C23H23NO6 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | N-naphthalen-2-yl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzamide |
| SMILES | O=C(Nc1ccc2ccccc2c1)c1cccc(C2OC(CO)C(O)C(O)C2O)c1 |
| InChI | InChI=1S/C23H23NO6/c25-12-18-19(26)20(27)21(28)22(30-18)15-6-3-7-16(10-15)23(29)24-17-9-8-13-4-1-2-5-14(13)11-17/h1-11,18-22,25-28H,12H2,(H,24,29) |
| InChIKey | IPXWOORCZDHBCF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-naphthalen-2-yl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-naphthalen-2-yl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzamide?
The IUPAC name of N-naphthalen-2-yl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzamide (CID 78162415) is N-naphthalen-2-yl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzamide.
What is the SMILES notation for N-naphthalen-2-yl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzamide?
The canonical SMILES for N-naphthalen-2-yl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzamide is O=C(Nc1ccc2ccccc2c1)c1cccc(C2OC(CO)C(O)C(O)C2O)c1.
What is the InChIKey of N-naphthalen-2-yl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzamide?
The InChIKey is IPXWOORCZDHBCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23NO6/c25-12-18-19(26)20(27)21(28)22(30-18)15-6-3-7-16(10-15)23(29)24-17-9-8-13-4-1-2-5-14(13)11-17/h1-11,18-22,25-28H,12H2,(H,24,29).
What are the key properties of N-naphthalen-2-yl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzamide?
N-naphthalen-2-yl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzamide has a molecular weight of 409.44 g/mol, XLogP of 1.61, 4 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-naphthalen-2-yl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzamide is sourced from PubChem (CID 78162415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).