C25H27NO7 — CID 175518420
N-[4-[2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]phenyl]naphthalene-2-carboxamide (PubChem CID 175518420) has the molecular formula C25H27NO7 and a molecular weight of 453.49 g/mol. Its IUPAC name is N-[4-[2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]phenyl]naphthalene-2-carboxamide.
| Compound Name | N-[4-[2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]phenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 175518420 |
| Molecular Formula | C25H27NO7 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | N-[4-[2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]phenyl]naphthalene-2-carboxamide |
| SMILES | O=C(Nc1ccc(CCO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C25H27NO7/c27-14-20-21(28)22(29)23(30)25(33-20)32-12-11-15-5-9-19(10-6-15)26-24(31)18-8-7-16-3-1-2-4-17(16)13-18/h1-10,13,20-23,25,27-30H,11-12,14H2,(H,26,31)/t20-,21-,22+,23-,25-/m1/s1 |
| InChIKey | ZTBUIHSZIFBLPF-MXCHMSEPSA-N |
| XLogP | 1.45 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |