C23H28O8 — CID 162661618
[4-[2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]phenyl] 4-ethylbenzoate (PubChem CID 162661618) has the molecular formula C23H28O8 and a molecular weight of 432.47 g/mol. Its IUPAC name is [4-[2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]phenyl] 4-ethylbenzoate.
| Compound Name | [4-[2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]phenyl] 4-ethylbenzoate |
|---|---|
| PubChem CID | 162661618 |
| Molecular Formula | C23H28O8 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | [4-[2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]phenyl] 4-ethylbenzoate |
| SMILES | CCc1ccc(C(=O)Oc2ccc(CCO[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc2)cc1 |
| InChI | InChI=1S/C23H28O8/c1-2-14-3-7-16(8-4-14)22(28)30-17-9-5-15(6-10-17)11-12-29-23-21(27)20(26)19(25)18(13-24)31-23/h3-10,18-21,23-27H,2,11-13H2,1H3/t18-,19-,20+,21-,23-/m1/s1 |
| InChIKey | HFXXVUMRAWXZAN-ZFVIQDPVSA-N |
| XLogP | 0.83 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|