C21H24O10 — CID 85355170
[2-[2-(3,4-dihydroxyphenyl)ethoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] 4-hydroxybenzoate (PubChem CID 85355170) has the molecular formula C21H24O10 and a molecular weight of 436.41 g/mol. Its IUPAC name is [2-[2-(3,4-dihydroxyphenyl)ethoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] 4-hydroxybenzoate.
| Compound Name | [2-[2-(3,4-dihydroxyphenyl)ethoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] 4-hydroxybenzoate |
|---|---|
| PubChem CID | 85355170 |
| Molecular Formula | C21H24O10 |
| Molecular Weight | 436.41 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | [2-[2-(3,4-dihydroxyphenyl)ethoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] 4-hydroxybenzoate |
| SMILES | O=C(OC1C(OCCc2ccc(O)c(O)c2)OC(CO)C(O)C1O)c1ccc(O)cc1 |
| InChI | InChI=1S/C21H24O10/c22-10-16-17(26)18(27)19(31-20(28)12-2-4-13(23)5-3-12)21(30-16)29-8-7-11-1-6-14(24)15(25)9-11/h1-6,9,16-19,21-27H,7-8,10H2 |
| InChIKey | FBFNBXHEVIRMBP-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 166.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.41 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|