C20H19ClN2O6S — CID 71731673
N-(6-chloro-1,3-benzothiazol-2-yl)-3-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzamide (PubChem CID 71731673) has the molecular formula C20H19ClN2O6S and a molecular weight of 450.90 g/mol. Its IUPAC name is N-(6-chloro-1,3-benzothiazol-2-yl)-3-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzamide.
| Compound Name | N-(6-chloro-1,3-benzothiazol-2-yl)-3-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzamide |
|---|---|
| PubChem CID | 71731673 |
| Molecular Formula | C20H19ClN2O6S |
| Molecular Weight | 450.90 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | N-(6-chloro-1,3-benzothiazol-2-yl)-3-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzamide |
| SMILES | O=C(Nc1nc2ccc(Cl)cc2s1)c1cccc([C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)c1 |
| InChI | InChI=1S/C20H19ClN2O6S/c21-11-4-5-12-14(7-11)30-20(22-12)23-19(28)10-3-1-2-9(6-10)18-17(27)16(26)15(25)13(8-24)29-18/h1-7,13,15-18,24-27H,8H2,(H,22,23,28)/t13-,15-,16+,17+,18-/m1/s1 |
| InChIKey | PVSZKZYKHUOXLM-FWEDZOCSSA-N |
| XLogP | 1.72 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.90 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |