C15H16O8 — CID 88741644
7-hydroxy-3-[(2R,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-2-one (PubChem CID 88741644) has the molecular formula C15H16O8 and a molecular weight of 324.29 g/mol. Its IUPAC name is 7-hydroxy-3-[(2R,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-2-one.
| Compound Name | 7-hydroxy-3-[(2R,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-2-one |
|---|---|
| PubChem CID | 88741644 |
| Molecular Formula | C15H16O8 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 7-hydroxy-3-[(2R,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-2-one |
| SMILES | O=c1oc2cc(O)ccc2cc1[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H16O8/c16-5-10-11(18)12(19)13(20)14(22-10)8-3-6-1-2-7(17)4-9(6)23-15(8)21/h1-4,10-14,16-20H,5H2/t10-,11+,12+,13-,14-/m1/s1 |
| InChIKey | YWMYLDKUXNQURC-MBJXGIAVSA-N |
| XLogP | -0.99 |
| TPSA | 140.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|