C18H18O9 — CID 87896637
9-methoxy-6-[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]furo[3,2-g]chromen-7-one (PubChem CID 87896637) has the molecular formula C18H18O9 and a molecular weight of 378.33 g/mol. Its IUPAC name is 9-methoxy-6-[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]furo[3,2-g]chromen-7-one.
| Compound Name | 9-methoxy-6-[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]furo[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 87896637 |
| Molecular Formula | C18H18O9 |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 9-methoxy-6-[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]furo[3,2-g]chromen-7-one |
| SMILES | COc1c2occc2cc2cc(C3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(=O)oc12 |
| InChI | InChI=1S/C18H18O9/c1-24-17-14-7(2-3-25-14)4-8-5-9(18(23)27-15(8)17)16-13(22)12(21)11(20)10(6-19)26-16/h2-5,10-13,16,19-22H,6H2,1H3/t10-,11-,12+,13-,16?/m1/s1 |
| InChIKey | DLZPIVYVHDACBH-QEUOUSRZSA-N |
| XLogP | 0.06 |
| TPSA | 142.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|