C20H19FO9 — CID 171936064
1-fluoro-4-methoxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzo[c]chromen-6-one (PubChem CID 171936064) has the molecular formula C20H19FO9 and a molecular weight of 422.36 g/mol. Its IUPAC name is 1-fluoro-4-methoxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzo[c]chromen-6-one.
| Compound Name | 1-fluoro-4-methoxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 171936064 |
| Molecular Formula | C20H19FO9 |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 1-fluoro-4-methoxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzo[c]chromen-6-one |
| SMILES | COc1c(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc(F)c2c1oc(=O)c1ccccc12 |
| InChI | InChI=1S/C20H19FO9/c1-27-17-11(28-20-16(25)15(24)14(23)12(7-22)29-20)6-10(21)13-8-4-2-3-5-9(8)19(26)30-18(13)17/h2-6,12,14-16,20,22-25H,7H2,1H3/t12-,14-,15+,16-,20-/m1/s1 |
| InChIKey | RQPARRGIMZYJJJ-FCTSWLAKSA-N |
| XLogP | 0.27 |
| TPSA | 138.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|