C21H18O13 — CID 162817575
6,7-dihydroxy-13-methoxy-14-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaene-3,10-dione (PubChem CID 162817575) has the molecular formula C21H18O13 and a molecular weight of 478.36 g/mol. Its IUPAC name is 6,7-dihydroxy-13-methoxy-14-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaene-3,10-dione.
| Compound Name | 6,7-dihydroxy-13-methoxy-14-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaene-3,10-dione |
|---|---|
| PubChem CID | 162817575 |
| Molecular Formula | C21H18O13 |
| Molecular Weight | 478.36 g/mol |
| Exact Mass | 478.07 |
| IUPAC Name | 6,7-dihydroxy-13-methoxy-14-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaene-3,10-dione |
| SMILES | COc1cc2c(=O)oc3c(O)c(O)cc4c(=O)oc(c1OC1OC(CO)C(O)C(O)C1O)c2c34 |
| InChI | InChI=1S/C21H18O13/c1-30-8-3-6-11-10-5(2-7(23)12(24)17(10)32-20(6)29)19(28)33-18(11)16(8)34-21-15(27)14(26)13(25)9(4-22)31-21/h2-3,9,13-15,21-27H,4H2,1H3 |
| InChIKey | WIYXGAGHMCEESA-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 209.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.36 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|