C22H22O8 — CID 102017102
7-phenylmethoxy-6-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-2-one (PubChem CID 102017102) has the molecular formula C22H22O8 and a molecular weight of 414.41 g/mol. Its IUPAC name is 7-phenylmethoxy-6-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-2-one.
| Compound Name | 7-phenylmethoxy-6-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-2-one |
|---|---|
| PubChem CID | 102017102 |
| Molecular Formula | C22H22O8 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 7-phenylmethoxy-6-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-2-one |
| SMILES | O=c1ccc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(OCc3ccccc3)cc2o1 |
| InChI | InChI=1S/C22H22O8/c23-10-17-19(25)20(26)21(27)22(30-17)14-8-13-6-7-18(24)29-15(13)9-16(14)28-11-12-4-2-1-3-5-12/h1-9,17,19-23,25-27H,10-11H2/t17-,19-,20+,21-,22+/m1/s1 |
| InChIKey | QUKZWEQUWWNYGH-VOFPXKNKSA-N |
| XLogP | 0.89 |
| TPSA | 129.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|