C41H46O14 — CID 134833985
1-[2,4,6-tris(phenylmethoxy)-3,5-bis[(2S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]ethanone (PubChem CID 134833985) has the molecular formula C41H46O14 and a molecular weight of 762.81 g/mol. Its IUPAC name is 1-[2,4,6-tris(phenylmethoxy)-3,5-bis[(2S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]ethanone.
| Compound Name | 1-[2,4,6-tris(phenylmethoxy)-3,5-bis[(2S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 134833985 |
| Molecular Formula | C41H46O14 |
| Molecular Weight | 762.81 g/mol |
| Exact Mass | 762.29 |
| IUPAC Name | 1-[2,4,6-tris(phenylmethoxy)-3,5-bis[(2S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]ethanone |
| SMILES | CC(=O)c1c(OCc2ccccc2)c([C@@H]2OC(CO)[C@@H](O)C(O)C2O)c(OCc2ccccc2)c([C@@H]2OC(CO)[C@@H](O)C(O)C2O)c1OCc1ccccc1 |
| InChI | InChI=1S/C41H46O14/c1-22(44)28-37(51-19-23-11-5-2-6-12-23)29(40-35(49)33(47)31(45)26(17-42)54-40)39(53-21-25-15-9-4-10-16-25)30(38(28)52-20-24-13-7-3-8-14-24)41-36(50)34(48)32(46)27(18-43)55-41/h2-16,26-27,31-36,40-43,45-50H,17-21H2,1H3/t26?,27?,31-,32-,33?,34?,35?,36?,40+,41+/m1/s1 |
| InChIKey | SJUINXKAZXUFEG-KSQBDSBPSA-N |
| XLogP | 1.66 |
| TPSA | 225.06 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.81 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |