C16H19N3O5S — CID 54056045
5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-phenylmethoxy-1H-pyrazole-3-carbothioamide (PubChem CID 54056045) has the molecular formula C16H19N3O5S and a molecular weight of 365.41 g/mol. Its IUPAC name is 5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-phenylmethoxy-1H-pyrazole-3-carbothioamide.
| Compound Name | 5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-phenylmethoxy-1H-pyrazole-3-carbothioamide |
|---|---|
| PubChem CID | 54056045 |
| Molecular Formula | C16H19N3O5S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-phenylmethoxy-1H-pyrazole-3-carbothioamide |
| SMILES | NC(=S)c1n[nH]c([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c1OCc1ccccc1 |
| InChI | InChI=1S/C16H19N3O5S/c17-16(25)11-14(23-7-8-4-2-1-3-5-8)10(18-19-11)15-13(22)12(21)9(6-20)24-15/h1-5,9,12-13,15,20-22H,6-7H2,(H2,17,25)(H,18,19)/t9-,12-,13-,15+/m1/s1 |
| InChIKey | LWIBODFDSLRMMN-OBEQPXDXSA-N |
| XLogP | -0.22 |
| TPSA | 133.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|